C9H10N2O5 — CID 65351968
2-(1,4-dioxan-2-yl)-6-oxo-1H-pyrimidine-5-carboxylic acid (PubChem CID 65351968) has the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-yl)-6-oxo-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 2-(1,4-dioxan-2-yl)-6-oxo-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 65351968 |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-(1,4-dioxan-2-yl)-6-oxo-1H-pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(C2COCCO2)[nH]c1=O |
| InChI | InChI=1S/C9H10N2O5/c12-8-5(9(13)14)3-10-7(11-8)6-4-15-1-2-16-6/h3,6H,1-2,4H2,(H,13,14)(H,10,11,12) |
| InChIKey | GWPSXKKNSMTFBT-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |