C10H19NO2 — CID 65352985
1-(1,4-dioxan-2-yl)-N-methylpent-4-en-1-amine (PubChem CID 65352985) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)-N-methylpent-4-en-1-amine.
| Compound Name | 1-(1,4-dioxan-2-yl)-N-methylpent-4-en-1-amine |
|---|---|
| PubChem CID | 65352985 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)-N-methylpent-4-en-1-amine |
| SMILES | C=CCCC(NC)C1COCCO1 |
| InChI | InChI=1S/C10H19NO2/c1-3-4-5-9(11-2)10-8-12-6-7-13-10/h3,9-11H,1,4-8H2,2H3 |
| InChIKey | ZCQUONCQYRJEQQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|