C14H16BrN3 — CID 65353287
2-[(3-bromophenyl)methyl]-4,5,6,7-tetrahydroindazol-3-amine (PubChem CID 65353287) has the molecular formula C14H16BrN3 and a molecular weight of 306.21 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-4,5,6,7-tetrahydroindazol-3-amine.
| Compound Name | 2-[(3-bromophenyl)methyl]-4,5,6,7-tetrahydroindazol-3-amine |
|---|---|
| PubChem CID | 65353287 |
| Molecular Formula | C14H16BrN3 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-4,5,6,7-tetrahydroindazol-3-amine |
| SMILES | Nc1c2c(nn1Cc1cccc(Br)c1)CCCC2 |
| InChI | InChI=1S/C14H16BrN3/c15-11-5-3-4-10(8-11)9-18-14(16)12-6-1-2-7-13(12)17-18/h3-5,8H,1-2,6-7,9,16H2 |
| InChIKey | VBJHMXRBLNLIKV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |