C18H25NO2 — CID 65353730
N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopent-3-en-1-yl]methyl]-2-methylpropan-1-amine (PubChem CID 65353730) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopent-3-en-1-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopent-3-en-1-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 65353730 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopent-3-en-1-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC1(c2ccc3c(c2)OCCO3)CC=CC1 |
| InChI | InChI=1S/C18H25NO2/c1-14(2)12-19-13-18(7-3-4-8-18)15-5-6-16-17(11-15)21-10-9-20-16/h3-6,11,14,19H,7-10,12-13H2,1-2H3 |
| InChIKey | JHTKAWDBNUSMFS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|