About 4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide
4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide (PubChem CID 65354860) has the molecular formula C12H10F2N4O3
and a molecular weight of 296.23 g/mol. Its IUPAC name is 4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide |
| PubChem CID | 65354860 |
| Molecular Formula | C12H10F2N4O3 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1cc(N)c(C(=O)Nc2ccc3c(c2)OC(F)(F)O3)n1 |
| InChI | InChI=1S/C12H10F2N4O3/c1-18-5-7(15)10(17-18)11(19)16-6-2-3-8-9(4-6)21-12(13,14)20-8/h2-5H,15H2,1H3,(H,16,19) |
| InChIKey | YOVIPLZFVBMZLJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide?
The IUPAC name of 4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide (CID 65354860) is 4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide.
What is the SMILES notation for 4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide?
The canonical SMILES for 4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide is Cn1cc(N)c(C(=O)Nc2ccc3c(c2)OC(F)(F)O3)n1.
What is the InChIKey of 4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide?
The InChIKey is YOVIPLZFVBMZLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N4O3/c1-18-5-7(15)10(17-18)11(19)16-6-2-3-8-9(4-6)21-12(13,14)20-8/h2-5H,15H2,1H3,(H,16,19).
What are the key properties of 4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide?
4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide has a molecular weight of 296.23 g/mol, XLogP of 1.58, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazole-3-carboxamide is sourced from PubChem (CID 65354860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).