C10H15N5O2 — CID 65354922
4-amino-N-[2-(cyclopropylamino)-2-oxoethyl]-1-methylpyrazole-3-carboxamide (PubChem CID 65354922) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 4-amino-N-[2-(cyclopropylamino)-2-oxoethyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | 4-amino-N-[2-(cyclopropylamino)-2-oxoethyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65354922 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 4-amino-N-[2-(cyclopropylamino)-2-oxoethyl]-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1cc(N)c(C(=O)NCC(=O)NC2CC2)n1 |
| InChI | InChI=1S/C10H15N5O2/c1-15-5-7(11)9(14-15)10(17)12-4-8(16)13-6-2-3-6/h5-6H,2-4,11H2,1H3,(H,12,17)(H,13,16) |
| InChIKey | KBNHPSBYUANFMT-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |