About 1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one
1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one (PubChem CID 65356666) has the molecular formula C11H10N4O
and a molecular weight of 214.23 g/mol. Its IUPAC name is 1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one.
Molecular Properties
| Compound Name | 1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one |
| PubChem CID | 65356666 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one |
| SMILES | O=C1CCCc2c1cnn2-c1ncccn1 |
| InChI | InChI=1S/C11H10N4O/c16-10-4-1-3-9-8(10)7-14-15(9)11-12-5-2-6-13-11/h2,5-7H,1,3-4H2 |
| InChIKey | HCJDQUYMZRBYEU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one?
The IUPAC name of 1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one (CID 65356666) is 1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one.
What is the SMILES notation for 1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one?
The canonical SMILES for 1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one is O=C1CCCc2c1cnn2-c1ncccn1.
What is the InChIKey of 1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one?
The InChIKey is HCJDQUYMZRBYEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O/c16-10-4-1-3-9-8(10)7-14-15(9)11-12-5-2-6-13-11/h2,5-7H,1,3-4H2.
What are the key properties of 1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one?
1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one has a molecular weight of 214.23 g/mol, XLogP of 1.18, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one is sourced from PubChem (CID 65356666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).