C10H16N4O2 — CID 65356930
4-(1,4-dioxan-2-yl)-6-propyl-1,3,5-triazin-2-amine (PubChem CID 65356930) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-(1,4-dioxan-2-yl)-6-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(1,4-dioxan-2-yl)-6-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 65356930 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4-(1,4-dioxan-2-yl)-6-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCc1nc(N)nc(C2COCCO2)n1 |
| InChI | InChI=1S/C10H16N4O2/c1-2-3-8-12-9(14-10(11)13-8)7-6-15-4-5-16-7/h7H,2-6H2,1H3,(H2,11,12,13,14) |
| InChIKey | OCQTZNBAMQPTCT-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |