C11H20N4O2 — CID 65357049
4-amino-1-ethyl-N-(2-hydroxyethyl)-N-propan-2-ylpyrazole-5-carboxamide (PubChem CID 65357049) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-(2-hydroxyethyl)-N-propan-2-ylpyrazole-5-carboxamide.
| Compound Name | 4-amino-1-ethyl-N-(2-hydroxyethyl)-N-propan-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 65357049 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 4-amino-1-ethyl-N-(2-hydroxyethyl)-N-propan-2-ylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(N)c1C(=O)N(CCO)C(C)C |
| InChI | InChI=1S/C11H20N4O2/c1-4-15-10(9(12)7-13-15)11(17)14(5-6-16)8(2)3/h7-8,16H,4-6,12H2,1-3H3 |
| InChIKey | NMWRCAZYBRFMLE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |