C15H21N5O — CID 65357815
4-amino-1-ethyl-N-propan-2-yl-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide (PubChem CID 65357815) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-propan-2-yl-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 4-amino-1-ethyl-N-propan-2-yl-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65357815 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 4-amino-1-ethyl-N-propan-2-yl-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide |
| SMILES | CCn1cc(N)c(C(=O)N(Cc2cccnc2)C(C)C)n1 |
| InChI | InChI=1S/C15H21N5O/c1-4-19-10-13(16)14(18-19)15(21)20(11(2)3)9-12-6-5-7-17-8-12/h5-8,10-11H,4,9,16H2,1-3H3 |
| InChIKey | WGPXIOQCIUROHD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |