C18H16N4S — CID 653599
2-amino-6-methyl-4-thiophen-2-yl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 653599) has the molecular formula C18H16N4S and a molecular weight of 320.42 g/mol. Its IUPAC name is 2-amino-6-methyl-4-thiophen-2-yl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | 2-amino-6-methyl-4-thiophen-2-yl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 653599 |
| Molecular Formula | C18H16N4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-amino-6-methyl-4-thiophen-2-yl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | CC1CC=C2C(C#N)=C(N)C(C#N)(C#N)C(c3cccs3)C2C1 |
| InChI | InChI=1S/C18H16N4S/c1-11-4-5-12-13(7-11)16(15-3-2-6-23-15)18(9-20,10-21)17(22)14(12)8-19/h2-3,5-6,11,13,16H,4,7,22H2,1H3 |
| InChIKey | NQLGNUDZYAUBPL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|