About N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine
N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine (PubChem CID 65360075) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine.
Molecular Properties
| Compound Name | N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine |
| PubChem CID | 65360075 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine |
| SMILES | C=CCCC(NC)c1ncn[nH]1 |
| InChI | InChI=1S/C8H14N4/c1-3-4-5-7(9-2)8-10-6-11-12-8/h3,6-7,9H,1,4-5H2,2H3,(H,10,11,12) |
| InChIKey | DAMNCGJSOKVZRM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine?
The IUPAC name of N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine (CID 65360075) is N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine.
What is the SMILES notation for N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine?
The canonical SMILES for N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine is C=CCCC(NC)c1ncn[nH]1.
What is the InChIKey of N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine?
The InChIKey is DAMNCGJSOKVZRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4/c1-3-4-5-7(9-2)8-10-6-11-12-8/h3,6-7,9H,1,4-5H2,2H3,(H,10,11,12).
What are the key properties of N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine?
N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine has a molecular weight of 166.23 g/mol, XLogP of 1.03, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(1H-1,2,4-triazol-5-yl)pent-4-en-1-amine is sourced from PubChem (CID 65360075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).