About N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine
N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine (PubChem CID 65360085) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine.
Molecular Properties
| Compound Name | N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine |
| PubChem CID | 65360085 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine |
| SMILES | C=CCCCC(NCC)c1ncn[nH]1 |
| InChI | InChI=1S/C10H18N4/c1-3-5-6-7-9(11-4-2)10-12-8-13-14-10/h3,8-9,11H,1,4-7H2,2H3,(H,12,13,14) |
| InChIKey | XIHRMESNAZICEC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine?
The IUPAC name of N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine (CID 65360085) is N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine.
What is the SMILES notation for N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine?
The canonical SMILES for N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine is C=CCCCC(NCC)c1ncn[nH]1.
What is the InChIKey of N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine?
The InChIKey is XIHRMESNAZICEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-3-5-6-7-9(11-4-2)10-12-8-13-14-10/h3,8-9,11H,1,4-7H2,2H3,(H,12,13,14).
What are the key properties of N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine?
N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine has a molecular weight of 194.28 g/mol, XLogP of 1.81, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine is sourced from PubChem (CID 65360085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).