About N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine
N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine (PubChem CID 65360098) has the molecular formula C11H20N4
and a molecular weight of 208.31 g/mol. Its IUPAC name is N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine.
Molecular Properties
| Compound Name | N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine |
| PubChem CID | 65360098 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine |
| SMILES | C=CCCCC(NCCC)c1ncn[nH]1 |
| InChI | InChI=1S/C11H20N4/c1-3-5-6-7-10(12-8-4-2)11-13-9-14-15-11/h3,9-10,12H,1,4-8H2,2H3,(H,13,14,15) |
| InChIKey | PNRBFNRNLLKYDO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine?
The IUPAC name of N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine (CID 65360098) is N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine.
What is the SMILES notation for N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine?
The canonical SMILES for N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine is C=CCCCC(NCCC)c1ncn[nH]1.
What is the InChIKey of N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine?
The InChIKey is PNRBFNRNLLKYDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4/c1-3-5-6-7-10(12-8-4-2)11-13-9-14-15-11/h3,9-10,12H,1,4-8H2,2H3,(H,13,14,15).
What are the key properties of N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine?
N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine has a molecular weight of 208.31 g/mol, XLogP of 2.20, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-1-(1H-1,2,4-triazol-5-yl)hex-5-en-1-amine is sourced from PubChem (CID 65360098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).