C11H20N4O — CID 65360467
N-[oxan-4-yl(1H-1,2,4-triazol-5-yl)methyl]propan-1-amine (PubChem CID 65360467) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is N-[oxan-4-yl(1H-1,2,4-triazol-5-yl)methyl]propan-1-amine.
| Compound Name | N-[oxan-4-yl(1H-1,2,4-triazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 65360467 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | N-[oxan-4-yl(1H-1,2,4-triazol-5-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ncn[nH]1)C1CCOCC1 |
| InChI | InChI=1S/C11H20N4O/c1-2-5-12-10(11-13-8-14-15-11)9-3-6-16-7-4-9/h8-10,12H,2-7H2,1H3,(H,13,14,15) |
| InChIKey | MPBWSUYAUCZUKF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |