About 4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one
4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one (PubChem CID 65360969) has the molecular formula C12H19N5O
and a molecular weight of 249.32 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one |
| PubChem CID | 65360969 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one |
| SMILES | Cc1nnc(N2CCCNC(=O)C2)c(CN)c1C |
| InChI | InChI=1S/C12H19N5O/c1-8-9(2)15-16-12(10(8)6-13)17-5-3-4-14-11(18)7-17/h3-7,13H2,1-2H3,(H,14,18) |
| InChIKey | FHNSZVKIGUZIIW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one?
The IUPAC name of 4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one (CID 65360969) is 4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one.
What is the SMILES notation for 4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one?
The canonical SMILES for 4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one is Cc1nnc(N2CCCNC(=O)C2)c(CN)c1C.
What is the InChIKey of 4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one?
The InChIKey is FHNSZVKIGUZIIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N5O/c1-8-9(2)15-16-12(10(8)6-13)17-5-3-4-14-11(18)7-17/h3-7,13H2,1-2H3,(H,14,18).
What are the key properties of 4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one?
4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one has a molecular weight of 249.32 g/mol, XLogP of -0.12, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(aminomethyl)-5,6-dimethylpyridazin-3-yl]-1,4-diazepan-2-one is sourced from PubChem (CID 65360969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).