About N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline
N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline (PubChem CID 6536099) has the molecular formula C21H19FN2
and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline.
Molecular Properties
| Compound Name | N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline |
| PubChem CID | 6536099 |
| Molecular Formula | C21H19FN2 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline |
| SMILES | Cc1cccc(N/N=C(/c2ccccc2)c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C21H19FN2/c1-15-7-6-10-20(16(15)2)23-24-21(17-8-4-3-5-9-17)18-11-13-19(22)14-12-18/h3-14,23H,1-2H3/b24-21- |
| InChIKey | MLQHNGSCFVDTFK-FLFQWRMESA-N |
| XLogP | 5.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline?
The IUPAC name of N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline (CID 6536099) is N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline.
What is the SMILES notation for N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline?
The canonical SMILES for N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline is Cc1cccc(N/N=C(/c2ccccc2)c2ccc(F)cc2)c1C.
What is the InChIKey of N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline?
The InChIKey is MLQHNGSCFVDTFK-FLFQWRMESA-N. The full InChI is InChI=1S/C21H19FN2/c1-15-7-6-10-20(16(15)2)23-24-21(17-8-4-3-5-9-17)18-11-13-19(22)14-12-18/h3-14,23H,1-2H3/b24-21-.
What are the key properties of N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline?
N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline has a molecular weight of 318.40 g/mol, XLogP of 5.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline is sourced from PubChem (CID 6536099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).