About 1-(2-methoxyethyl)-1,4-diazepan-2-one
1-(2-methoxyethyl)-1,4-diazepan-2-one (PubChem CID 65362069) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-1,4-diazepan-2-one |
| PubChem CID | 65362069 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 1-(2-methoxyethyl)-1,4-diazepan-2-one |
| SMILES | COCCN1CCCNCC1=O |
| InChI | InChI=1S/C8H16N2O2/c1-12-6-5-10-4-2-3-9-7-8(10)11/h9H,2-7H2,1H3 |
| InChIKey | QNNQFWDKUBSTNM-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-methoxyethyl)-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-1,4-diazepan-2-one?
The IUPAC name of 1-(2-methoxyethyl)-1,4-diazepan-2-one (CID 65362069) is 1-(2-methoxyethyl)-1,4-diazepan-2-one.
What is the SMILES notation for 1-(2-methoxyethyl)-1,4-diazepan-2-one?
The canonical SMILES for 1-(2-methoxyethyl)-1,4-diazepan-2-one is COCCN1CCCNCC1=O.
What is the InChIKey of 1-(2-methoxyethyl)-1,4-diazepan-2-one?
The InChIKey is QNNQFWDKUBSTNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-12-6-5-10-4-2-3-9-7-8(10)11/h9H,2-7H2,1H3.
What are the key properties of 1-(2-methoxyethyl)-1,4-diazepan-2-one?
1-(2-methoxyethyl)-1,4-diazepan-2-one has a molecular weight of 172.23 g/mol, XLogP of -0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-1,4-diazepan-2-one is sourced from PubChem (CID 65362069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).