About N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide
N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide (PubChem CID 65362324) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide.
Molecular Properties
| Compound Name | N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide |
| PubChem CID | 65362324 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide |
| SMILES | CCNC(=O)CN1CCCNCC1=O |
| InChI | InChI=1S/C9H17N3O2/c1-2-11-8(13)7-12-5-3-4-10-6-9(12)14/h10H,2-7H2,1H3,(H,11,13) |
| InChIKey | DPYKZFFIECVUQL-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide?
The IUPAC name of N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide (CID 65362324) is N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide.
What is the SMILES notation for N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide?
The canonical SMILES for N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide is CCNC(=O)CN1CCCNCC1=O.
What is the InChIKey of N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide?
The InChIKey is DPYKZFFIECVUQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2/c1-2-11-8(13)7-12-5-3-4-10-6-9(12)14/h10H,2-7H2,1H3,(H,11,13).
What are the key properties of N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide?
N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide has a molecular weight of 199.25 g/mol, XLogP of -1.06, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-(2-oxo-1,4-diazepan-1-yl)acetamide is sourced from PubChem (CID 65362324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).