About 2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone
2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone (PubChem CID 65362636) has the molecular formula C11H11N3O
and a molecular weight of 201.23 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone |
| PubChem CID | 65362636 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone |
| SMILES | Cc1ccccc1CC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C11H11N3O/c1-8-4-2-3-5-9(8)6-10(15)11-12-7-13-14-11/h2-5,7H,6H2,1H3,(H,12,13,14) |
| InChIKey | GUXMXTJFNPXNSL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone?
The IUPAC name of 2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone (CID 65362636) is 2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone.
What is the SMILES notation for 2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone?
The canonical SMILES for 2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone is Cc1ccccc1CC(=O)c1ncn[nH]1.
What is the InChIKey of 2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone?
The InChIKey is GUXMXTJFNPXNSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O/c1-8-4-2-3-5-9(8)6-10(15)11-12-7-13-14-11/h2-5,7H,6H2,1H3,(H,12,13,14).
What are the key properties of 2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone?
2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone has a molecular weight of 201.23 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanone is sourced from PubChem (CID 65362636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).