About (3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone
(3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone (PubChem CID 65362877) has the molecular formula C7H4BrN3O2
and a molecular weight of 242.03 g/mol. Its IUPAC name is (3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone.
Molecular Properties
| Compound Name | (3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone |
| PubChem CID | 65362877 |
| Molecular Formula | C7H4BrN3O2 |
| Molecular Weight | 242.03 g/mol |
| Exact Mass | 240.95 |
| IUPAC Name | (3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone |
| SMILES | O=C(c1ncn[nH]1)c1occc1Br |
| InChI | InChI=1S/C7H4BrN3O2/c8-4-1-2-13-6(4)5(12)7-9-3-10-11-7/h1-3H,(H,9,10,11) |
| InChIKey | UJJVHGOHKJOIEI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.03 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone?
The IUPAC name of (3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone (CID 65362877) is (3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone.
What is the SMILES notation for (3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone?
The canonical SMILES for (3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone is O=C(c1ncn[nH]1)c1occc1Br.
What is the InChIKey of (3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone?
The InChIKey is UJJVHGOHKJOIEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrN3O2/c8-4-1-2-13-6(4)5(12)7-9-3-10-11-7/h1-3H,(H,9,10,11).
What are the key properties of (3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone?
(3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone has a molecular weight of 242.03 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methanone is sourced from PubChem (CID 65362877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).