C11H16N6O — CID 65362915
4-amino-1-ethyl-N-[(1-methylimidazol-2-yl)methyl]pyrazole-3-carboxamide (PubChem CID 65362915) has the molecular formula C11H16N6O and a molecular weight of 248.29 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-[(1-methylimidazol-2-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | 4-amino-1-ethyl-N-[(1-methylimidazol-2-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65362915 |
| Molecular Formula | C11H16N6O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-amino-1-ethyl-N-[(1-methylimidazol-2-yl)methyl]pyrazole-3-carboxamide |
| SMILES | CCn1cc(N)c(C(=O)NCc2nccn2C)n1 |
| InChI | InChI=1S/C11H16N6O/c1-3-17-7-8(12)10(15-17)11(18)14-6-9-13-4-5-16(9)2/h4-5,7H,3,6,12H2,1-2H3,(H,14,18) |
| InChIKey | ZCUWBCYZADILIH-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |