C8H14N4O — CID 65363356
oxan-4-yl(1H-1,2,4-triazol-5-yl)methanamine (PubChem CID 65363356) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is oxan-4-yl(1H-1,2,4-triazol-5-yl)methanamine.
| Compound Name | oxan-4-yl(1H-1,2,4-triazol-5-yl)methanamine |
|---|---|
| PubChem CID | 65363356 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | oxan-4-yl(1H-1,2,4-triazol-5-yl)methanamine |
| SMILES | NC(c1ncn[nH]1)C1CCOCC1 |
| InChI | InChI=1S/C8H14N4O/c9-7(8-10-5-11-12-8)6-1-3-13-4-2-6/h5-7H,1-4,9H2,(H,10,11,12) |
| InChIKey | CIEALOQETUGDSA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |