C9H12N6 — CID 65363413
4-[2-amino-2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine (PubChem CID 65363413) has the molecular formula C9H12N6 and a molecular weight of 204.24 g/mol. Its IUPAC name is 4-[2-amino-2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine.
| Compound Name | 4-[2-amino-2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 65363413 |
| Molecular Formula | C9H12N6 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 4-[2-amino-2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine |
| SMILES | Nc1cc(CC(N)c2ncn[nH]2)ccn1 |
| InChI | InChI=1S/C9H12N6/c10-7(9-13-5-14-15-9)3-6-1-2-12-8(11)4-6/h1-2,4-5,7H,3,10H2,(H2,11,12)(H,13,14,15) |
| InChIKey | DOXDVTATZIVZNF-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |