C16H18N2O3 — CID 65363566
4-[3-(4-hydroxybut-1-ynyl)benzoyl]-1,4-diazepan-2-one (PubChem CID 65363566) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-[3-(4-hydroxybut-1-ynyl)benzoyl]-1,4-diazepan-2-one.
| Compound Name | 4-[3-(4-hydroxybut-1-ynyl)benzoyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65363566 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 4-[3-(4-hydroxybut-1-ynyl)benzoyl]-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)c2cccc(C#CCCO)c2)CCCN1 |
| InChI | InChI=1S/C16H18N2O3/c19-10-2-1-5-13-6-3-7-14(11-13)16(21)18-9-4-8-17-15(20)12-18/h3,6-7,11,19H,2,4,8-10,12H2,(H,17,20) |
| InChIKey | QRSQVGJSJXPMDI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|