About ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate
ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate (PubChem CID 65363959) has the molecular formula C9H14N2O4
and a molecular weight of 214.22 g/mol. Its IUPAC name is ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate |
| PubChem CID | 65363959 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate |
| SMILES | CCOC(=O)C(=O)N1CCCNC(=O)C1 |
| InChI | InChI=1S/C9H14N2O4/c1-2-15-9(14)8(13)11-5-3-4-10-7(12)6-11/h2-6H2,1H3,(H,10,12) |
| InChIKey | ZLBUXBQMPPEOTP-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate?
The IUPAC name of ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate (CID 65363959) is ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate.
What is the SMILES notation for ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate?
The canonical SMILES for ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate is CCOC(=O)C(=O)N1CCCNC(=O)C1.
What is the InChIKey of ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate?
The InChIKey is ZLBUXBQMPPEOTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O4/c1-2-15-9(14)8(13)11-5-3-4-10-7(12)6-11/h2-6H2,1H3,(H,10,12).
What are the key properties of ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate?
ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate has a molecular weight of 214.22 g/mol, XLogP of -1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-oxo-2-(3-oxo-1,4-diazepan-1-yl)acetate is sourced from PubChem (CID 65363959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).