About 4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid
4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid (PubChem CID 65364013) has the molecular formula C12H15N3O3
and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid.
Molecular Properties
| Compound Name | 4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid |
| PubChem CID | 65364013 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid |
| SMILES | Nc1ccc(C(=O)O)c(N2CCCNC(=O)C2)c1 |
| InChI | InChI=1S/C12H15N3O3/c13-8-2-3-9(12(17)18)10(6-8)15-5-1-4-14-11(16)7-15/h2-3,6H,1,4-5,7,13H2,(H,14,16)(H,17,18) |
| InChIKey | URXOKUOLYRWFDH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid?
The IUPAC name of 4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid (CID 65364013) is 4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid.
What is the SMILES notation for 4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid?
The canonical SMILES for 4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid is Nc1ccc(C(=O)O)c(N2CCCNC(=O)C2)c1.
What is the InChIKey of 4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid?
The InChIKey is URXOKUOLYRWFDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O3/c13-8-2-3-9(12(17)18)10(6-8)15-5-1-4-14-11(16)7-15/h2-3,6H,1,4-5,7,13H2,(H,14,16)(H,17,18).
What are the key properties of 4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid?
4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid has a molecular weight of 249.27 g/mol, XLogP of 0.29, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(3-oxo-1,4-diazepan-1-yl)benzoic acid is sourced from PubChem (CID 65364013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).