About 3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid
3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid (PubChem CID 65364092) has the molecular formula C13H23N3O4
and a molecular weight of 285.34 g/mol. Its IUPAC name is 3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid |
| PubChem CID | 65364092 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid |
| SMILES | CC(C)(C)N(CCC(=O)O)C(=O)N1CCCNC(=O)C1 |
| InChI | InChI=1S/C13H23N3O4/c1-13(2,3)16(8-5-11(18)19)12(20)15-7-4-6-14-10(17)9-15/h4-9H2,1-3H3,(H,14,17)(H,18,19) |
| InChIKey | DBWUTJVZGNFJCU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid?
The IUPAC name of 3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid (CID 65364092) is 3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid.
What is the SMILES notation for 3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid?
The canonical SMILES for 3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid is CC(C)(C)N(CCC(=O)O)C(=O)N1CCCNC(=O)C1.
What is the InChIKey of 3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid?
The InChIKey is DBWUTJVZGNFJCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O4/c1-13(2,3)16(8-5-11(18)19)12(20)15-7-4-6-14-10(17)9-15/h4-9H2,1-3H3,(H,14,17)(H,18,19).
What are the key properties of 3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid?
3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid has a molecular weight of 285.34 g/mol, XLogP of 0.50, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl-(3-oxo-1,4-diazepane-1-carbonyl)amino]propanoic acid is sourced from PubChem (CID 65364092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).