About 7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol
7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol (PubChem CID 65365060) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is 7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol.
Molecular Properties
| Compound Name | 7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol |
| PubChem CID | 65365060 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol |
| SMILES | COCOc1ccc2c(c1)OC(C)(C)CC2O |
| InChI | InChI=1S/C13H18O4/c1-13(2)7-11(14)10-5-4-9(16-8-15-3)6-12(10)17-13/h4-6,11,14H,7-8H2,1-3H3 |
| InChIKey | YQZDMGIOHLYWTQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol?
The IUPAC name of 7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol (CID 65365060) is 7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol.
What is the SMILES notation for 7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol?
The canonical SMILES for 7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol is COCOc1ccc2c(c1)OC(C)(C)CC2O.
What is the InChIKey of 7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol?
The InChIKey is YQZDMGIOHLYWTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4/c1-13(2)7-11(14)10-5-4-9(16-8-15-3)6-12(10)17-13/h4-6,11,14H,7-8H2,1-3H3.
What are the key properties of 7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol?
7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol has a molecular weight of 238.28 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrochromen-4-ol is sourced from PubChem (CID 65365060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).