About 4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one
4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one (PubChem CID 65365240) has the molecular formula C13H18N2O3S
and a molecular weight of 282.36 g/mol. Its IUPAC name is 4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
| PubChem CID | 65365240 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
| SMILES | CCCCS(=O)(=O)N1CC(=O)Nc2ccccc2C1 |
| InChI | InChI=1S/C13H18N2O3S/c1-2-3-8-19(17,18)15-9-11-6-4-5-7-12(11)14-13(16)10-15/h4-7H,2-3,8-10H2,1H3,(H,14,16) |
| InChIKey | ZHEOYGPKHNSFHR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one?
The IUPAC name of 4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one (CID 65365240) is 4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one.
What is the SMILES notation for 4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one?
The canonical SMILES for 4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one is CCCCS(=O)(=O)N1CC(=O)Nc2ccccc2C1.
What is the InChIKey of 4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one?
The InChIKey is ZHEOYGPKHNSFHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3S/c1-2-3-8-19(17,18)15-9-11-6-4-5-7-12(11)14-13(16)10-15/h4-7H,2-3,8-10H2,1H3,(H,14,16).
What are the key properties of 4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one?
4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one has a molecular weight of 282.36 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylsulfonyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one is sourced from PubChem (CID 65365240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).