C18H19N3O3S2 — CID 653662
5-(1-benzylsulfonylpiperidin-4-yl)-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 653662) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 5-(1-benzylsulfonylpiperidin-4-yl)-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(1-benzylsulfonylpiperidin-4-yl)-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 653662 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 5-(1-benzylsulfonylpiperidin-4-yl)-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCC(c2nc(-c3cccs3)no2)CC1 |
| InChI | InChI=1S/C18H19N3O3S2/c22-26(23,13-14-5-2-1-3-6-14)21-10-8-15(9-11-21)18-19-17(20-24-18)16-7-4-12-25-16/h1-7,12,15H,8-11,13H2 |
| InChIKey | CACGICJDAQUQPD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |