About 4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one
4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one (PubChem CID 65366601) has the molecular formula C10H16N4OS
and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one |
| PubChem CID | 65366601 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one |
| SMILES | CC(N)c1cnc(N2CCCNC(=O)C2)s1 |
| InChI | InChI=1S/C10H16N4OS/c1-7(11)8-5-13-10(16-8)14-4-2-3-12-9(15)6-14/h5,7H,2-4,6,11H2,1H3,(H,12,15) |
| InChIKey | LIYCWSBSCXIJAQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one?
The IUPAC name of 4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one (CID 65366601) is 4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one.
What is the SMILES notation for 4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one?
The canonical SMILES for 4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one is CC(N)c1cnc(N2CCCNC(=O)C2)s1.
What is the InChIKey of 4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one?
The InChIKey is LIYCWSBSCXIJAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4OS/c1-7(11)8-5-13-10(16-8)14-4-2-3-12-9(15)6-14/h5,7H,2-4,6,11H2,1H3,(H,12,15).
What are the key properties of 4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one?
4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one has a molecular weight of 240.33 g/mol, XLogP of 0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(1-aminoethyl)-1,3-thiazol-2-yl]-1,4-diazepan-2-one is sourced from PubChem (CID 65366601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).