C13H14Cl3NO3S — CID 65366806
2,4-dichloro-3-(cyclohexylcarbamoyl)benzenesulfonyl chloride (PubChem CID 65366806) has the molecular formula C13H14Cl3NO3S and a molecular weight of 370.69 g/mol. Its IUPAC name is 2,4-dichloro-3-(cyclohexylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 2,4-dichloro-3-(cyclohexylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65366806 |
| Molecular Formula | C13H14Cl3NO3S |
| Molecular Weight | 370.69 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 2,4-dichloro-3-(cyclohexylcarbamoyl)benzenesulfonyl chloride |
| SMILES | O=C(NC1CCCCC1)c1c(Cl)ccc(S(=O)(=O)Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl3NO3S/c14-9-6-7-10(21(16,19)20)12(15)11(9)13(18)17-8-4-2-1-3-5-8/h6-8H,1-5H2,(H,17,18) |
| InChIKey | ICALQCJHNZQVSH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.69 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |