C12H17ClN2O3S — CID 65366989
5-(2-methylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride (PubChem CID 65366989) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is 5-(2-methylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride.
| Compound Name | 5-(2-methylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65366989 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 5-(2-methylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride |
| SMILES | CC1CCCCCN1C(=O)c1cc(S(=O)(=O)Cl)c[nH]1 |
| InChI | InChI=1S/C12H17ClN2O3S/c1-9-5-3-2-4-6-15(9)12(16)11-7-10(8-14-11)19(13,17)18/h7-9,14H,2-6H2,1H3 |
| InChIKey | BHDNMILMCGXBCZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |