C10H13ClN2O3S — CID 65367180
5-[cyclopropylmethyl(methyl)carbamoyl]-1H-pyrrole-3-sulfonyl chloride (PubChem CID 65367180) has the molecular formula C10H13ClN2O3S and a molecular weight of 276.75 g/mol. Its IUPAC name is 5-[cyclopropylmethyl(methyl)carbamoyl]-1H-pyrrole-3-sulfonyl chloride.
| Compound Name | 5-[cyclopropylmethyl(methyl)carbamoyl]-1H-pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65367180 |
| Molecular Formula | C10H13ClN2O3S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 5-[cyclopropylmethyl(methyl)carbamoyl]-1H-pyrrole-3-sulfonyl chloride |
| SMILES | CN(CC1CC1)C(=O)c1cc(S(=O)(=O)Cl)c[nH]1 |
| InChI | InChI=1S/C10H13ClN2O3S/c1-13(6-7-2-3-7)10(14)9-4-8(5-12-9)17(11,15)16/h4-5,7,12H,2-3,6H2,1H3 |
| InChIKey | BIIGRESGGFKLFG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |