C11H14ClNO3S2 — CID 65367626
4-(3-methylpiperidine-1-carbonyl)thiophene-2-sulfonyl chloride (PubChem CID 65367626) has the molecular formula C11H14ClNO3S2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 4-(3-methylpiperidine-1-carbonyl)thiophene-2-sulfonyl chloride.
| Compound Name | 4-(3-methylpiperidine-1-carbonyl)thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 65367626 |
| Molecular Formula | C11H14ClNO3S2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 4-(3-methylpiperidine-1-carbonyl)thiophene-2-sulfonyl chloride |
| SMILES | CC1CCCN(C(=O)c2csc(S(=O)(=O)Cl)c2)C1 |
| InChI | InChI=1S/C11H14ClNO3S2/c1-8-3-2-4-13(6-8)11(14)9-5-10(17-7-9)18(12,15)16/h5,7-8H,2-4,6H2,1H3 |
| InChIKey | RMXWEXLWPNLJQE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |