C25H44O6 — CID 6536847
1,3-diacetyloxypropan-2-yl (E)-octadec-9-enoate (PubChem CID 6536847) has the molecular formula C25H44O6 and a molecular weight of 440.62 g/mol. Its IUPAC name is 1,3-diacetyloxypropan-2-yl (E)-octadec-9-enoate.
| Compound Name | 1,3-diacetyloxypropan-2-yl (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 6536847 |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | 1,3-diacetyloxypropan-2-yl (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OC(COC(C)=O)COC(C)=O |
| InChI | InChI=1S/C25H44O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(28)31-24(20-29-22(2)26)21-30-23(3)27/h11-12,24H,4-10,13-21H2,1-3H3/b12-11+ |
| InChIKey | DAYZEZNVBPBOQL-VAWYXSNFSA-N |
| XLogP | 6.06 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|