About spiro[1,3-dioxane-2,3'-1H-indole]-2'-one
spiro[1,3-dioxane-2,3'-1H-indole]-2'-one (PubChem CID 653687) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is spiro[1,3-dioxane-2,3'-1H-indole]-2'-one.
Molecular Properties
| Compound Name | spiro[1,3-dioxane-2,3'-1H-indole]-2'-one |
| PubChem CID | 653687 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | spiro[1,3-dioxane-2,3'-1H-indole]-2'-one |
| SMILES | O=C1Nc2ccccc2C12OCCCO2 |
| InChI | InChI=1S/C11H11NO3/c13-10-11(14-6-3-7-15-11)8-4-1-2-5-9(8)12-10/h1-2,4-5H,3,6-7H2,(H,12,13) |
| InChIKey | FPCFCMNSACXKRQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[1,3-dioxane-2,3'-1H-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
The IUPAC name of spiro[1,3-dioxane-2,3'-1H-indole]-2'-one (CID 653687) is spiro[1,3-dioxane-2,3'-1H-indole]-2'-one.
What is the SMILES notation for spiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
The canonical SMILES for spiro[1,3-dioxane-2,3'-1H-indole]-2'-one is O=C1Nc2ccccc2C12OCCCO2.
What is the InChIKey of spiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
The InChIKey is FPCFCMNSACXKRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c13-10-11(14-6-3-7-15-11)8-4-1-2-5-9(8)12-10/h1-2,4-5H,3,6-7H2,(H,12,13).
What are the key properties of spiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
spiro[1,3-dioxane-2,3'-1H-indole]-2'-one has a molecular weight of 205.21 g/mol, XLogP of 1.23, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxane-2,3'-1H-indole]-2'-one is sourced from PubChem (CID 653687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).