C12H18ClNO2 — CID 65369845
1-[5-chloro-2-(ethoxymethoxy)phenyl]-N-methylethanamine (PubChem CID 65369845) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is 1-[5-chloro-2-(ethoxymethoxy)phenyl]-N-methylethanamine.
| Compound Name | 1-[5-chloro-2-(ethoxymethoxy)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 65369845 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-[5-chloro-2-(ethoxymethoxy)phenyl]-N-methylethanamine |
| SMILES | CCOCOc1ccc(Cl)cc1C(C)NC |
| InChI | InChI=1S/C12H18ClNO2/c1-4-15-8-16-12-6-5-10(13)7-11(12)9(2)14-3/h5-7,9,14H,4,8H2,1-3H3 |
| InChIKey | LDZAQUMDOFGZTG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|