About 5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine
5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine (PubChem CID 65369868) has the molecular formula C6H12N4OS
and a molecular weight of 188.26 g/mol. Its IUPAC name is 5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine |
| PubChem CID | 65369868 |
| Molecular Formula | C6H12N4OS |
| Molecular Weight | 188.26 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine |
| SMILES | CCOCSc1nnc(N)n1C |
| InChI | InChI=1S/C6H12N4OS/c1-3-11-4-12-6-9-8-5(7)10(6)2/h3-4H2,1-2H3,(H2,7,8) |
| InChIKey | TYPOJVQUXWBDMP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine?
The IUPAC name of 5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine (CID 65369868) is 5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine?
The canonical SMILES for 5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine is CCOCSc1nnc(N)n1C.
What is the InChIKey of 5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine?
The InChIKey is TYPOJVQUXWBDMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4OS/c1-3-11-4-12-6-9-8-5(7)10(6)2/h3-4H2,1-2H3,(H2,7,8).
What are the key properties of 5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine?
5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine has a molecular weight of 188.26 g/mol, XLogP of 0.48, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethoxymethylsulfanyl)-4-methyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 65369868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).