About 5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride
5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride (PubChem CID 65370442) has the molecular formula C11H13ClF3NO3S2
and a molecular weight of 363.81 g/mol. Its IUPAC name is 5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride.
Molecular Properties
| Compound Name | 5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride |
| PubChem CID | 65370442 |
| Molecular Formula | C11H13ClF3NO3S2 |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride |
| SMILES | CCCN(CC(F)(F)F)C(=O)Cc1ccc(S(=O)(=O)Cl)s1 |
| InChI | InChI=1S/C11H13ClF3NO3S2/c1-2-5-16(7-11(13,14)15)9(17)6-8-3-4-10(20-8)21(12,18)19/h3-4H,2,5-7H2,1H3 |
| InChIKey | QWLBUPYZCATEAB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride?
The IUPAC name of 5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride (CID 65370442) is 5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride.
What is the SMILES notation for 5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride?
The canonical SMILES for 5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride is CCCN(CC(F)(F)F)C(=O)Cc1ccc(S(=O)(=O)Cl)s1.
What is the InChIKey of 5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride?
The InChIKey is QWLBUPYZCATEAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClF3NO3S2/c1-2-5-16(7-11(13,14)15)9(17)6-8-3-4-10(20-8)21(12,18)19/h3-4H,2,5-7H2,1H3.
What are the key properties of 5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride?
5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride has a molecular weight of 363.81 g/mol, XLogP of 3.02, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]thiophene-2-sulfonyl chloride is sourced from PubChem (CID 65370442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).