C13H17Cl2NO3S — CID 65370538
4-chloro-3-[methyl(pentyl)carbamoyl]benzenesulfonyl chloride (PubChem CID 65370538) has the molecular formula C13H17Cl2NO3S and a molecular weight of 338.26 g/mol. Its IUPAC name is 4-chloro-3-[methyl(pentyl)carbamoyl]benzenesulfonyl chloride.
| Compound Name | 4-chloro-3-[methyl(pentyl)carbamoyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65370538 |
| Molecular Formula | C13H17Cl2NO3S |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 4-chloro-3-[methyl(pentyl)carbamoyl]benzenesulfonyl chloride |
| SMILES | CCCCCN(C)C(=O)c1cc(S(=O)(=O)Cl)ccc1Cl |
| InChI | InChI=1S/C13H17Cl2NO3S/c1-3-4-5-8-16(2)13(17)11-9-10(20(15,18)19)6-7-12(11)14/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | GBVPVCGZTDGFKT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|