C13H14CuF6N2O2 — CID 6537109
copper (Z)-1,1,1-trifluoro-4-[2-[[(Z)-5,5,5-trifluoro-4-oxidopent-3-en-2-ylidene]amino]propylimino]pent-2-en-2-olate (PubChem CID 6537109) has the molecular formula C13H14CuF6N2O2 and a molecular weight of 407.80 g/mol. Its IUPAC name is copper (Z)-1,1,1-trifluoro-4-[2-[[(Z)-5,5,5-trifluoro-4-oxidopent-3-en-2-ylidene]amino]propylimino]pent-2-en-2-olate.
| Compound Name | copper (Z)-1,1,1-trifluoro-4-[2-[[(Z)-5,5,5-trifluoro-4-oxidopent-3-en-2-ylidene]amino]propylimino]pent-2-en-2-olate |
|---|---|
| PubChem CID | 6537109 |
| Molecular Formula | C13H14CuF6N2O2 |
| Molecular Weight | 407.80 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | copper (Z)-1,1,1-trifluoro-4-[2-[[(Z)-5,5,5-trifluoro-4-oxidopent-3-en-2-ylidene]amino]propylimino]pent-2-en-2-olate |
| SMILES | CC(/C=C(\[O-])C(F)(F)F)=N\CC(C)/N=C(C)/C=C(\[O-])C(F)(F)F.[Cu+2] |
| InChI | InChI=1S/C13H16F6N2O2.Cu/c1-7(4-10(22)12(14,15)16)20-6-9(3)21-8(2)5-11(23)13(17,18)19;/h4-5,9,22-23H,6H2,1-3H3;/q;+2/p-2/b10-4-,11-5-,20-7+,21-8+; |
| InChIKey | GVWBRQYJDHUMJL-UCGFNCQOSA-L |
| XLogP | 1.91 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.80 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|