About 3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride
3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride (PubChem CID 65372551) has the molecular formula C9H11ClF3N3O3S
and a molecular weight of 333.72 g/mol. Its IUPAC name is 3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride |
| PubChem CID | 65372551 |
| Molecular Formula | C9H11ClF3N3O3S |
| Molecular Weight | 333.72 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride |
| SMILES | CCN(CC(F)(F)F)C(=O)c1n[nH]c(C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C9H11ClF3N3O3S/c1-3-16(4-9(11,12)13)8(17)6-7(20(10,18)19)5(2)14-15-6/h3-4H2,1-2H3,(H,14,15) |
| InChIKey | FTUCHROWXMPTIW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.72 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride?
The IUPAC name of 3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride (CID 65372551) is 3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride.
What is the SMILES notation for 3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride?
The canonical SMILES for 3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride is CCN(CC(F)(F)F)C(=O)c1n[nH]c(C)c1S(=O)(=O)Cl.
What is the InChIKey of 3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride?
The InChIKey is FTUCHROWXMPTIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClF3N3O3S/c1-3-16(4-9(11,12)13)8(17)6-7(20(10,18)19)5(2)14-15-6/h3-4H2,1-2H3,(H,14,15).
What are the key properties of 3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride?
3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride has a molecular weight of 333.72 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl(2,2,2-trifluoroethyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride is sourced from PubChem (CID 65372551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).