About N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide
N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide (PubChem CID 65373323) has the molecular formula C11H12F2N2O3S
and a molecular weight of 290.29 g/mol. Its IUPAC name is N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide.
Molecular Properties
| Compound Name | N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide |
| PubChem CID | 65373323 |
| Molecular Formula | C11H12F2N2O3S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide |
| SMILES | CN(C(=O)c1cc(F)cc(S(N)(=O)=O)c1F)C1CC1 |
| InChI | InChI=1S/C11H12F2N2O3S/c1-15(7-2-3-7)11(16)8-4-6(12)5-9(10(8)13)19(14,17)18/h4-5,7H,2-3H2,1H3,(H2,14,17,18) |
| InChIKey | LPXWZEJOMIFRHK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide?
The IUPAC name of N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide (CID 65373323) is N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide.
What is the SMILES notation for N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide?
The canonical SMILES for N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide is CN(C(=O)c1cc(F)cc(S(N)(=O)=O)c1F)C1CC1.
What is the InChIKey of N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide?
The InChIKey is LPXWZEJOMIFRHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2N2O3S/c1-15(7-2-3-7)11(16)8-4-6(12)5-9(10(8)13)19(14,17)18/h4-5,7H,2-3H2,1H3,(H2,14,17,18).
What are the key properties of N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide?
N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide has a molecular weight of 290.29 g/mol, XLogP of 0.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2,5-difluoro-N-methyl-3-sulfamoylbenzamide is sourced from PubChem (CID 65373323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).