About oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate
oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate (PubChem CID 65373370) has the molecular formula C11H15ClN2O5S
and a molecular weight of 322.77 g/mol. Its IUPAC name is oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate |
| PubChem CID | 65373370 |
| Molecular Formula | C11H15ClN2O5S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate |
| SMILES | Cc1[nH]nc(C(=O)OCC2CCOCC2)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H15ClN2O5S/c1-7-10(20(12,16)17)9(14-13-7)11(15)19-6-8-2-4-18-5-3-8/h8H,2-6H2,1H3,(H,13,14) |
| InChIKey | WVLRLLIANGYWGV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate?
The IUPAC name of oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate (CID 65373370) is oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate.
What is the SMILES notation for oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate?
The canonical SMILES for oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate is Cc1[nH]nc(C(=O)OCC2CCOCC2)c1S(=O)(=O)Cl.
What is the InChIKey of oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate?
The InChIKey is WVLRLLIANGYWGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2O5S/c1-7-10(20(12,16)17)9(14-13-7)11(15)19-6-8-2-4-18-5-3-8/h8H,2-6H2,1H3,(H,13,14).
What are the key properties of oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate?
oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate has a molecular weight of 322.77 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-ylmethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate is sourced from PubChem (CID 65373370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).