C10H16Cl6 — CID 6537498
2,3,4,5,6,8-hexachlorodecane (PubChem CID 6537498) has the molecular formula C10H16Cl6 and a molecular weight of 348.96 g/mol. Its IUPAC name is 2,3,4,5,6,8-hexachlorodecane.
| Compound Name | 2,3,4,5,6,8-hexachlorodecane |
|---|---|
| PubChem CID | 6537498 |
| Molecular Formula | C10H16Cl6 |
| Molecular Weight | 348.96 g/mol |
| Exact Mass | 345.94 |
| IUPAC Name | 2,3,4,5,6,8-hexachlorodecane |
| SMILES | CCC(Cl)CC(Cl)C(Cl)C(Cl)C(Cl)C(C)Cl |
| InChI | InChI=1S/C10H16Cl6/c1-3-6(12)4-7(13)9(15)10(16)8(14)5(2)11/h5-10H,3-4H2,1-2H3 |
| InChIKey | GJGHBJCMOWRRSZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.96 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|