C14H16FNO — CID 65377847
1-[(3-fluoro-4-methoxyphenyl)methyl]cyclopentane-1-carbonitrile (PubChem CID 65377847) has the molecular formula C14H16FNO and a molecular weight of 233.29 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methoxyphenyl)methyl]cyclopentane-1-carbonitrile.
| Compound Name | 1-[(3-fluoro-4-methoxyphenyl)methyl]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 65377847 |
| Molecular Formula | C14H16FNO |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-[(3-fluoro-4-methoxyphenyl)methyl]cyclopentane-1-carbonitrile |
| SMILES | COc1ccc(CC2(C#N)CCCC2)cc1F |
| InChI | InChI=1S/C14H16FNO/c1-17-13-5-4-11(8-12(13)15)9-14(10-16)6-2-3-7-14/h4-5,8H,2-3,6-7,9H2,1H3 |
| InChIKey | GRIMVMUFUDWYNP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |