About N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine
N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine (PubChem CID 65377912) has the molecular formula C12H13FN4
and a molecular weight of 232.26 g/mol. Its IUPAC name is N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine |
| PubChem CID | 65377912 |
| Molecular Formula | C12H13FN4 |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine |
| SMILES | NCC(Nc1ccc(F)cc1)c1ccncn1 |
| InChI | InChI=1S/C12H13FN4/c13-9-1-3-10(4-2-9)17-12(7-14)11-5-6-15-8-16-11/h1-6,8,12,17H,7,14H2 |
| InChIKey | HUNUUAPEKYGPAT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine?
The IUPAC name of N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine (CID 65377912) is N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine.
What is the SMILES notation for N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine?
The canonical SMILES for N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine is NCC(Nc1ccc(F)cc1)c1ccncn1.
What is the InChIKey of N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine?
The InChIKey is HUNUUAPEKYGPAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN4/c13-9-1-3-10(4-2-9)17-12(7-14)11-5-6-15-8-16-11/h1-6,8,12,17H,7,14H2.
What are the key properties of N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine?
N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine has a molecular weight of 232.26 g/mol, XLogP of 1.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-1-pyrimidin-4-ylethane-1,2-diamine is sourced from PubChem (CID 65377912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).