C16H17ClN2 — CID 65378129
2-(aminomethyl)-N-(2-chlorophenyl)-1,3-dihydroinden-2-amine (PubChem CID 65378129) has the molecular formula C16H17ClN2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2-chlorophenyl)-1,3-dihydroinden-2-amine.
| Compound Name | 2-(aminomethyl)-N-(2-chlorophenyl)-1,3-dihydroinden-2-amine |
|---|---|
| PubChem CID | 65378129 |
| Molecular Formula | C16H17ClN2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-(aminomethyl)-N-(2-chlorophenyl)-1,3-dihydroinden-2-amine |
| SMILES | NCC1(Nc2ccccc2Cl)Cc2ccccc2C1 |
| InChI | InChI=1S/C16H17ClN2/c17-14-7-3-4-8-15(14)19-16(11-18)9-12-5-1-2-6-13(12)10-16/h1-8,19H,9-11,18H2 |
| InChIKey | QHXGQNQCXWMTGB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |